C20H17BrCl2N2O4 — CID 67759283
2-[6-(bromomethyl)-1-[(3,4-dichlorophenyl)methyl]-5-ethyl-2,4-dioxoquinazolin-3-yl]acetic acid (PubChem CID 67759283) has the molecular formula C20H17BrCl2N2O4 and a molecular weight of 500.18 g/mol. Its IUPAC name is 2-[6-(bromomethyl)-1-[(3,4-dichlorophenyl)methyl]-5-ethyl-2,4-dioxoquinazolin-3-yl]acetic acid.
| Compound Name | 2-[6-(bromomethyl)-1-[(3,4-dichlorophenyl)methyl]-5-ethyl-2,4-dioxoquinazolin-3-yl]acetic acid |
|---|---|
| PubChem CID | 67759283 |
| Molecular Formula | C20H17BrCl2N2O4 |
| Molecular Weight | 500.18 g/mol |
| Exact Mass | 497.97 |
| IUPAC Name | 2-[6-(bromomethyl)-1-[(3,4-dichlorophenyl)methyl]-5-ethyl-2,4-dioxoquinazolin-3-yl]acetic acid |
| SMILES | CCc1c(CBr)ccc2c1c(=O)n(CC(=O)O)c(=O)n2Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H17BrCl2N2O4/c1-2-13-12(8-21)4-6-16-18(13)19(28)25(10-17(26)27)20(29)24(16)9-11-3-5-14(22)15(23)7-11/h3-7H,2,8-10H2,1H3,(H,26,27) |
| InChIKey | ZMHFYNQOHGUAHP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.18 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|