C10H12ClN — CID 67759432
4-chloro-2-methyl-6,7,8,8a-tetrahydroquinoline (PubChem CID 67759432) has the molecular formula C10H12ClN and a molecular weight of 181.67 g/mol. Its IUPAC name is 4-chloro-2-methyl-6,7,8,8a-tetrahydroquinoline.
| Compound Name | 4-chloro-2-methyl-6,7,8,8a-tetrahydroquinoline |
|---|---|
| PubChem CID | 67759432 |
| Molecular Formula | C10H12ClN |
| Molecular Weight | 181.67 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 4-chloro-2-methyl-6,7,8,8a-tetrahydroquinoline |
| SMILES | CC1=NC2CCCC=C2C(Cl)=C1 |
| InChI | InChI=1S/C10H12ClN/c1-7-6-9(11)8-4-2-3-5-10(8)12-7/h4,6,10H,2-3,5H2,1H3 |
| InChIKey | NLJZRYPKTHYHHP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.67 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |