About 1-pentyl-7,7a-dihydro-2H-indol-3-one
1-pentyl-7,7a-dihydro-2H-indol-3-one (PubChem CID 67760388) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-pentyl-7,7a-dihydro-2H-indol-3-one.
Molecular Properties
| Compound Name | 1-pentyl-7,7a-dihydro-2H-indol-3-one |
| PubChem CID | 67760388 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-pentyl-7,7a-dihydro-2H-indol-3-one |
| SMILES | CCCCCN1CC(=O)C2=CC=CCC21 |
| InChI | InChI=1S/C13H19NO/c1-2-3-6-9-14-10-13(15)11-7-4-5-8-12(11)14/h4-5,7,12H,2-3,6,8-10H2,1H3 |
| InChIKey | UNNJEFPALKDWPX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-pentyl-7,7a-dihydro-2H-indol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentyl-7,7a-dihydro-2H-indol-3-one?
The IUPAC name of 1-pentyl-7,7a-dihydro-2H-indol-3-one (CID 67760388) is 1-pentyl-7,7a-dihydro-2H-indol-3-one.
What is the SMILES notation for 1-pentyl-7,7a-dihydro-2H-indol-3-one?
The canonical SMILES for 1-pentyl-7,7a-dihydro-2H-indol-3-one is CCCCCN1CC(=O)C2=CC=CCC21.
What is the InChIKey of 1-pentyl-7,7a-dihydro-2H-indol-3-one?
The InChIKey is UNNJEFPALKDWPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-2-3-6-9-14-10-13(15)11-7-4-5-8-12(11)14/h4-5,7,12H,2-3,6,8-10H2,1H3.
What are the key properties of 1-pentyl-7,7a-dihydro-2H-indol-3-one?
1-pentyl-7,7a-dihydro-2H-indol-3-one has a molecular weight of 205.30 g/mol, XLogP of 2.32, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentyl-7,7a-dihydro-2H-indol-3-one is sourced from PubChem (CID 67760388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).