About 2,5-dimethyl-1-phenylpyrrole-3,4-dicarbaldehyde
2,5-dimethyl-1-phenylpyrrole-3,4-dicarbaldehyde (PubChem CID 677605) has the molecular formula C14H13NO2
and a molecular weight of 227.26 g/mol. Its IUPAC name is 2,5-dimethyl-1-phenylpyrrole-3,4-dicarbaldehyde.
Molecular Properties
| Compound Name | 2,5-dimethyl-1-phenylpyrrole-3,4-dicarbaldehyde |
| PubChem CID | 677605 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 2,5-dimethyl-1-phenylpyrrole-3,4-dicarbaldehyde |
| SMILES | Cc1c(C=O)c(C=O)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C14H13NO2/c1-10-13(8-16)14(9-17)11(2)15(10)12-6-4-3-5-7-12/h3-9H,1-2H3 |
| InChIKey | YAJAIRFZIPHSNA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethyl-1-phenylpyrrole-3,4-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-1-phenylpyrrole-3,4-dicarbaldehyde?
The IUPAC name of 2,5-dimethyl-1-phenylpyrrole-3,4-dicarbaldehyde (CID 677605) is 2,5-dimethyl-1-phenylpyrrole-3,4-dicarbaldehyde.
What is the SMILES notation for 2,5-dimethyl-1-phenylpyrrole-3,4-dicarbaldehyde?
The canonical SMILES for 2,5-dimethyl-1-phenylpyrrole-3,4-dicarbaldehyde is Cc1c(C=O)c(C=O)c(C)n1-c1ccccc1.
What is the InChIKey of 2,5-dimethyl-1-phenylpyrrole-3,4-dicarbaldehyde?
The InChIKey is YAJAIRFZIPHSNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO2/c1-10-13(8-16)14(9-17)11(2)15(10)12-6-4-3-5-7-12/h3-9H,1-2H3.
What are the key properties of 2,5-dimethyl-1-phenylpyrrole-3,4-dicarbaldehyde?
2,5-dimethyl-1-phenylpyrrole-3,4-dicarbaldehyde has a molecular weight of 227.26 g/mol, XLogP of 2.72, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-1-phenylpyrrole-3,4-dicarbaldehyde is sourced from PubChem (CID 677605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).