About 4,6-diethylpyrimidine;N-methylmethanamine
4,6-diethylpyrimidine;N-methylmethanamine (PubChem CID 67760637) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is 4,6-diethylpyrimidine;N-methylmethanamine.
Molecular Properties
| Compound Name | 4,6-diethylpyrimidine;N-methylmethanamine |
| PubChem CID | 67760637 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 4,6-diethylpyrimidine;N-methylmethanamine |
| SMILES | CCc1cc(CC)ncn1.CNC |
| InChI | InChI=1S/C8H12N2.C2H7N/c1-3-7-5-8(4-2)10-6-9-7;1-3-2/h5-6H,3-4H2,1-2H3;3H,1-2H3 |
| InChIKey | GYXUMQDUPUQSOX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,6-diethylpyrimidine;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-diethylpyrimidine;N-methylmethanamine?
The IUPAC name of 4,6-diethylpyrimidine;N-methylmethanamine (CID 67760637) is 4,6-diethylpyrimidine;N-methylmethanamine.
What is the SMILES notation for 4,6-diethylpyrimidine;N-methylmethanamine?
The canonical SMILES for 4,6-diethylpyrimidine;N-methylmethanamine is CCc1cc(CC)ncn1.CNC.
What is the InChIKey of 4,6-diethylpyrimidine;N-methylmethanamine?
The InChIKey is GYXUMQDUPUQSOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2.C2H7N/c1-3-7-5-8(4-2)10-6-9-7;1-3-2/h5-6H,3-4H2,1-2H3;3H,1-2H3.
What are the key properties of 4,6-diethylpyrimidine;N-methylmethanamine?
4,6-diethylpyrimidine;N-methylmethanamine has a molecular weight of 181.28 g/mol, XLogP of 1.44, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-diethylpyrimidine;N-methylmethanamine is sourced from PubChem (CID 67760637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).