C25H33ClO5 — CID 67760785
(1S,2R,3R,5S)-5-[3-(4-chlorophenyl)propoxy]-3-[3-(4-methoxyphenyl)propoxy]cyclohexane-1,2-diol (PubChem CID 67760785) has the molecular formula C25H33ClO5 and a molecular weight of 448.99 g/mol. Its IUPAC name is (1S,2R,3R,5S)-5-[3-(4-chlorophenyl)propoxy]-3-[3-(4-methoxyphenyl)propoxy]cyclohexane-1,2-diol.
| Compound Name | (1S,2R,3R,5S)-5-[3-(4-chlorophenyl)propoxy]-3-[3-(4-methoxyphenyl)propoxy]cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 67760785 |
| Molecular Formula | C25H33ClO5 |
| Molecular Weight | 448.99 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | (1S,2R,3R,5S)-5-[3-(4-chlorophenyl)propoxy]-3-[3-(4-methoxyphenyl)propoxy]cyclohexane-1,2-diol |
| SMILES | COc1ccc(CCCO[C@@H]2C[C@@H](OCCCc3ccc(Cl)cc3)C[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C25H33ClO5/c1-29-21-12-8-19(9-13-21)5-3-15-31-24-17-22(16-23(27)25(24)28)30-14-2-4-18-6-10-20(26)11-7-18/h6-13,22-25,27-28H,2-5,14-17H2,1H3/t22-,23-,24+,25+/m0/s1 |
| InChIKey | BGKIXCLDDYSVEB-CXSMSNRLSA-N |
| XLogP | 4.20 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.99 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|