C19H26Cl2N6O5S — CID 67761171
ethyl 2-[[(2S)-2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-5-(1H-imidazol-2-ylamino)pentanoyl]-methylamino]acetate (PubChem CID 67761171) has the molecular formula C19H26Cl2N6O5S and a molecular weight of 521.43 g/mol. Its IUPAC name is ethyl 2-[[(2S)-2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-5-(1H-imidazol-2-ylamino)pentanoyl]-methylamino]acetate.
| Compound Name | ethyl 2-[[(2S)-2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-5-(1H-imidazol-2-ylamino)pentanoyl]-methylamino]acetate |
|---|---|
| PubChem CID | 67761171 |
| Molecular Formula | C19H26Cl2N6O5S |
| Molecular Weight | 521.43 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | ethyl 2-[[(2S)-2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-5-(1H-imidazol-2-ylamino)pentanoyl]-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)C(=O)[C@H](CCCNc1ncc[nH]1)NS(=O)(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C19H26Cl2N6O5S/c1-3-32-16(28)11-27(2)18(29)15(5-4-6-23-19-24-7-8-25-19)26-33(30,31)12-9-13(20)17(22)14(21)10-12/h7-10,15,26H,3-6,11,22H2,1-2H3,(H2,23,24,25)/t15-/m0/s1 |
| InChIKey | JMXQKIDUYAXWOX-HNNXBMFYSA-N |
| XLogP | 1.86 |
| TPSA | 159.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|