C23H26N2O — CID 67761395
2-[1-(4-oxo-4-phenylbutyl)piperidin-4-yl]-2-phenylacetonitrile (PubChem CID 67761395) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is 2-[1-(4-oxo-4-phenylbutyl)piperidin-4-yl]-2-phenylacetonitrile.
| Compound Name | 2-[1-(4-oxo-4-phenylbutyl)piperidin-4-yl]-2-phenylacetonitrile |
|---|---|
| PubChem CID | 67761395 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 2-[1-(4-oxo-4-phenylbutyl)piperidin-4-yl]-2-phenylacetonitrile |
| SMILES | N#CC(c1ccccc1)C1CCN(CCCC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H26N2O/c24-18-22(19-8-3-1-4-9-19)20-13-16-25(17-14-20)15-7-12-23(26)21-10-5-2-6-11-21/h1-6,8-11,20,22H,7,12-17H2 |
| InChIKey | WNRKPSMOWSAUGT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |