C18H24Cl2N6O5S — CID 67761577
2-[[(2S)-2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-5-(1H-imidazol-2-ylamino)pentanoyl]-ethylamino]acetic acid (PubChem CID 67761577) has the molecular formula C18H24Cl2N6O5S and a molecular weight of 507.40 g/mol. Its IUPAC name is 2-[[(2S)-2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-5-(1H-imidazol-2-ylamino)pentanoyl]-ethylamino]acetic acid.
| Compound Name | 2-[[(2S)-2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-5-(1H-imidazol-2-ylamino)pentanoyl]-ethylamino]acetic acid |
|---|---|
| PubChem CID | 67761577 |
| Molecular Formula | C18H24Cl2N6O5S |
| Molecular Weight | 507.40 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | 2-[[(2S)-2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-5-(1H-imidazol-2-ylamino)pentanoyl]-ethylamino]acetic acid |
| SMILES | CCN(CC(=O)O)C(=O)[C@H](CCCNc1ncc[nH]1)NS(=O)(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C18H24Cl2N6O5S/c1-2-26(10-15(27)28)17(29)14(4-3-5-22-18-23-6-7-24-18)25-32(30,31)11-8-12(19)16(21)13(20)9-11/h6-9,14,25H,2-5,10,21H2,1H3,(H,27,28)(H2,22,23,24)/t14-/m0/s1 |
| InChIKey | DYDYLMQRTZMZBA-AWEZNQCLSA-N |
| XLogP | 1.77 |
| TPSA | 170.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|