About ethyl 2-amino-5-bromo-3H-1,3-thiazole-2-carboxylate
ethyl 2-amino-5-bromo-3H-1,3-thiazole-2-carboxylate (PubChem CID 67762035) has the molecular formula C6H9BrN2O2S
and a molecular weight of 253.12 g/mol. Its IUPAC name is ethyl 2-amino-5-bromo-3H-1,3-thiazole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-amino-5-bromo-3H-1,3-thiazole-2-carboxylate |
| PubChem CID | 67762035 |
| Molecular Formula | C6H9BrN2O2S |
| Molecular Weight | 253.12 g/mol |
| Exact Mass | 251.96 |
| IUPAC Name | ethyl 2-amino-5-bromo-3H-1,3-thiazole-2-carboxylate |
| SMILES | CCOC(=O)C1(N)NC=C(Br)S1 |
| InChI | InChI=1S/C6H9BrN2O2S/c1-2-11-5(10)6(8)9-3-4(7)12-6/h3,9H,2,8H2,1H3 |
| InChIKey | SWTJNRUREQVTCB-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.12 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-amino-5-bromo-3H-1,3-thiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-amino-5-bromo-3H-1,3-thiazole-2-carboxylate?
The IUPAC name of ethyl 2-amino-5-bromo-3H-1,3-thiazole-2-carboxylate (CID 67762035) is ethyl 2-amino-5-bromo-3H-1,3-thiazole-2-carboxylate.
What is the SMILES notation for ethyl 2-amino-5-bromo-3H-1,3-thiazole-2-carboxylate?
The canonical SMILES for ethyl 2-amino-5-bromo-3H-1,3-thiazole-2-carboxylate is CCOC(=O)C1(N)NC=C(Br)S1.
What is the InChIKey of ethyl 2-amino-5-bromo-3H-1,3-thiazole-2-carboxylate?
The InChIKey is SWTJNRUREQVTCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrN2O2S/c1-2-11-5(10)6(8)9-3-4(7)12-6/h3,9H,2,8H2,1H3.
What are the key properties of ethyl 2-amino-5-bromo-3H-1,3-thiazole-2-carboxylate?
ethyl 2-amino-5-bromo-3H-1,3-thiazole-2-carboxylate has a molecular weight of 253.12 g/mol, XLogP of 0.69, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-amino-5-bromo-3H-1,3-thiazole-2-carboxylate is sourced from PubChem (CID 67762035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).