About 9-chlorobenzo[b][1,4]benzoxazepine
9-chlorobenzo[b][1,4]benzoxazepine (PubChem CID 67762093) has the molecular formula C13H8ClNO
and a molecular weight of 229.67 g/mol. Its IUPAC name is 9-chlorobenzo[b][1,4]benzoxazepine.
Molecular Properties
| Compound Name | 9-chlorobenzo[b][1,4]benzoxazepine |
| PubChem CID | 67762093 |
| Molecular Formula | C13H8ClNO |
| Molecular Weight | 229.67 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 9-chlorobenzo[b][1,4]benzoxazepine |
| SMILES | Clc1ccc2c(c1)Oc1ccccc1N=C2 |
| InChI | InChI=1S/C13H8ClNO/c14-10-6-5-9-8-15-11-3-1-2-4-12(11)16-13(9)7-10/h1-8H |
| InChIKey | UZZPJRQQMTWAOL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.67 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-chlorobenzo[b][1,4]benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chlorobenzo[b][1,4]benzoxazepine?
The IUPAC name of 9-chlorobenzo[b][1,4]benzoxazepine (CID 67762093) is 9-chlorobenzo[b][1,4]benzoxazepine.
What is the SMILES notation for 9-chlorobenzo[b][1,4]benzoxazepine?
The canonical SMILES for 9-chlorobenzo[b][1,4]benzoxazepine is Clc1ccc2c(c1)Oc1ccccc1N=C2.
What is the InChIKey of 9-chlorobenzo[b][1,4]benzoxazepine?
The InChIKey is UZZPJRQQMTWAOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClNO/c14-10-6-5-9-8-15-11-3-1-2-4-12(11)16-13(9)7-10/h1-8H.
What are the key properties of 9-chlorobenzo[b][1,4]benzoxazepine?
9-chlorobenzo[b][1,4]benzoxazepine has a molecular weight of 229.67 g/mol, XLogP of 4.20, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chlorobenzo[b][1,4]benzoxazepine is sourced from PubChem (CID 67762093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).