About [2,3-bis(2-chloroethyl)phenyl]methanamine
[2,3-bis(2-chloroethyl)phenyl]methanamine (PubChem CID 67762306) has the molecular formula C11H15Cl2N
and a molecular weight of 232.15 g/mol. Its IUPAC name is [2,3-bis(2-chloroethyl)phenyl]methanamine.
Molecular Properties
| Compound Name | [2,3-bis(2-chloroethyl)phenyl]methanamine |
| PubChem CID | 67762306 |
| Molecular Formula | C11H15Cl2N |
| Molecular Weight | 232.15 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | [2,3-bis(2-chloroethyl)phenyl]methanamine |
| SMILES | NCc1cccc(CCCl)c1CCCl |
| InChI | InChI=1S/C11H15Cl2N/c12-6-4-9-2-1-3-10(8-14)11(9)5-7-13/h1-3H,4-8,14H2 |
| InChIKey | BIYGZMNYACZYMN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.15 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [2,3-bis(2-chloroethyl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-bis(2-chloroethyl)phenyl]methanamine?
The IUPAC name of [2,3-bis(2-chloroethyl)phenyl]methanamine (CID 67762306) is [2,3-bis(2-chloroethyl)phenyl]methanamine.
What is the SMILES notation for [2,3-bis(2-chloroethyl)phenyl]methanamine?
The canonical SMILES for [2,3-bis(2-chloroethyl)phenyl]methanamine is NCc1cccc(CCCl)c1CCCl.
What is the InChIKey of [2,3-bis(2-chloroethyl)phenyl]methanamine?
The InChIKey is BIYGZMNYACZYMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15Cl2N/c12-6-4-9-2-1-3-10(8-14)11(9)5-7-13/h1-3H,4-8,14H2.
What are the key properties of [2,3-bis(2-chloroethyl)phenyl]methanamine?
[2,3-bis(2-chloroethyl)phenyl]methanamine has a molecular weight of 232.15 g/mol, XLogP of 2.71, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-bis(2-chloroethyl)phenyl]methanamine is sourced from PubChem (CID 67762306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).