About 4-[6-(1-butylimidazolidin-2-ylidene)-4-methylcyclohexa-1,3-dien-1-yl]morpholine
4-[6-(1-butylimidazolidin-2-ylidene)-4-methylcyclohexa-1,3-dien-1-yl]morpholine (PubChem CID 67763041) has the molecular formula C18H29N3O
and a molecular weight of 303.45 g/mol. Its IUPAC name is 4-[6-(1-butylimidazolidin-2-ylidene)-4-methylcyclohexa-1,3-dien-1-yl]morpholine.
Molecular Properties
| Compound Name | 4-[6-(1-butylimidazolidin-2-ylidene)-4-methylcyclohexa-1,3-dien-1-yl]morpholine |
| PubChem CID | 67763041 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | 4-[6-(1-butylimidazolidin-2-ylidene)-4-methylcyclohexa-1,3-dien-1-yl]morpholine |
| SMILES | CCCCN1CCNC1=C1CC(C)=CC=C1N1CCOCC1 |
| InChI | InChI=1S/C18H29N3O/c1-3-4-8-21-9-7-19-18(21)16-14-15(2)5-6-17(16)20-10-12-22-13-11-20/h5-6,19H,3-4,7-14H2,1-2H3 |
| InChIKey | PUBWNGRGYZHSEI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[6-(1-butylimidazolidin-2-ylidene)-4-methylcyclohexa-1,3-dien-1-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-(1-butylimidazolidin-2-ylidene)-4-methylcyclohexa-1,3-dien-1-yl]morpholine?
The IUPAC name of 4-[6-(1-butylimidazolidin-2-ylidene)-4-methylcyclohexa-1,3-dien-1-yl]morpholine (CID 67763041) is 4-[6-(1-butylimidazolidin-2-ylidene)-4-methylcyclohexa-1,3-dien-1-yl]morpholine.
What is the SMILES notation for 4-[6-(1-butylimidazolidin-2-ylidene)-4-methylcyclohexa-1,3-dien-1-yl]morpholine?
The canonical SMILES for 4-[6-(1-butylimidazolidin-2-ylidene)-4-methylcyclohexa-1,3-dien-1-yl]morpholine is CCCCN1CCNC1=C1CC(C)=CC=C1N1CCOCC1.
What is the InChIKey of 4-[6-(1-butylimidazolidin-2-ylidene)-4-methylcyclohexa-1,3-dien-1-yl]morpholine?
The InChIKey is PUBWNGRGYZHSEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N3O/c1-3-4-8-21-9-7-19-18(21)16-14-15(2)5-6-17(16)20-10-12-22-13-11-20/h5-6,19H,3-4,7-14H2,1-2H3.
What are the key properties of 4-[6-(1-butylimidazolidin-2-ylidene)-4-methylcyclohexa-1,3-dien-1-yl]morpholine?
4-[6-(1-butylimidazolidin-2-ylidene)-4-methylcyclohexa-1,3-dien-1-yl]morpholine has a molecular weight of 303.45 g/mol, XLogP of 2.47, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-(1-butylimidazolidin-2-ylidene)-4-methylcyclohexa-1,3-dien-1-yl]morpholine is sourced from PubChem (CID 67763041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).