About 6-(dimethylamino)-2-methylhex-2-enamide;2-ethenyl-1H-imidazole
6-(dimethylamino)-2-methylhex-2-enamide;2-ethenyl-1H-imidazole (PubChem CID 67763538) has the molecular formula C14H24N4O
and a molecular weight of 264.37 g/mol. Its IUPAC name is 6-(dimethylamino)-2-methylhex-2-enamide;2-ethenyl-1H-imidazole.
Molecular Properties
| Compound Name | 6-(dimethylamino)-2-methylhex-2-enamide;2-ethenyl-1H-imidazole |
| PubChem CID | 67763538 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 6-(dimethylamino)-2-methylhex-2-enamide;2-ethenyl-1H-imidazole |
| SMILES | C=Cc1ncc[nH]1.CC(=CCCCN(C)C)C(N)=O |
| InChI | InChI=1S/C9H18N2O.C5H6N2/c1-8(9(10)12)6-4-5-7-11(2)3;1-2-5-6-3-4-7-5/h6H,4-5,7H2,1-3H3,(H2,10,12);2-4H,1H2,(H,6,7) |
| InChIKey | HCWGIUZHSGUHOC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-(dimethylamino)-2-methylhex-2-enamide;2-ethenyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(dimethylamino)-2-methylhex-2-enamide;2-ethenyl-1H-imidazole?
The IUPAC name of 6-(dimethylamino)-2-methylhex-2-enamide;2-ethenyl-1H-imidazole (CID 67763538) is 6-(dimethylamino)-2-methylhex-2-enamide;2-ethenyl-1H-imidazole.
What is the SMILES notation for 6-(dimethylamino)-2-methylhex-2-enamide;2-ethenyl-1H-imidazole?
The canonical SMILES for 6-(dimethylamino)-2-methylhex-2-enamide;2-ethenyl-1H-imidazole is C=Cc1ncc[nH]1.CC(=CCCCN(C)C)C(N)=O.
What is the InChIKey of 6-(dimethylamino)-2-methylhex-2-enamide;2-ethenyl-1H-imidazole?
The InChIKey is HCWGIUZHSGUHOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O.C5H6N2/c1-8(9(10)12)6-4-5-7-11(2)3;1-2-5-6-3-4-7-5/h6H,4-5,7H2,1-3H3,(H2,10,12);2-4H,1H2,(H,6,7).
What are the key properties of 6-(dimethylamino)-2-methylhex-2-enamide;2-ethenyl-1H-imidazole?
6-(dimethylamino)-2-methylhex-2-enamide;2-ethenyl-1H-imidazole has a molecular weight of 264.37 g/mol, XLogP of 1.81, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(dimethylamino)-2-methylhex-2-enamide;2-ethenyl-1H-imidazole is sourced from PubChem (CID 67763538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).