About 2-[4-[2-[[3-(2,3-diaminophenoxy)-2-hydroxypropyl]amino]propan-2-yl]phenoxy]acetic acid
2-[4-[2-[[3-(2,3-diaminophenoxy)-2-hydroxypropyl]amino]propan-2-yl]phenoxy]acetic acid (PubChem CID 67763614) has the molecular formula C20H27N3O5
and a molecular weight of 389.45 g/mol. Its IUPAC name is 2-[4-[2-[[3-(2,3-diaminophenoxy)-2-hydroxypropyl]amino]propan-2-yl]phenoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[4-[2-[[3-(2,3-diaminophenoxy)-2-hydroxypropyl]amino]propan-2-yl]phenoxy]acetic acid |
| PubChem CID | 67763614 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 2-[4-[2-[[3-(2,3-diaminophenoxy)-2-hydroxypropyl]amino]propan-2-yl]phenoxy]acetic acid |
| SMILES | CC(C)(NCC(O)COc1cccc(N)c1N)c1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C20H27N3O5/c1-20(2,13-6-8-15(9-7-13)27-12-18(25)26)23-10-14(24)11-28-17-5-3-4-16(21)19(17)22/h3-9,14,23-24H,10-12,21-22H2,1-2H3,(H,25,26) |
| InChIKey | QQVUQROHEHRVQF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[2-[[3-(2,3-diaminophenoxy)-2-hydroxypropyl]amino]propan-2-yl]phenoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-[[3-(2,3-diaminophenoxy)-2-hydroxypropyl]amino]propan-2-yl]phenoxy]acetic acid?
The IUPAC name of 2-[4-[2-[[3-(2,3-diaminophenoxy)-2-hydroxypropyl]amino]propan-2-yl]phenoxy]acetic acid (CID 67763614) is 2-[4-[2-[[3-(2,3-diaminophenoxy)-2-hydroxypropyl]amino]propan-2-yl]phenoxy]acetic acid.
What is the SMILES notation for 2-[4-[2-[[3-(2,3-diaminophenoxy)-2-hydroxypropyl]amino]propan-2-yl]phenoxy]acetic acid?
The canonical SMILES for 2-[4-[2-[[3-(2,3-diaminophenoxy)-2-hydroxypropyl]amino]propan-2-yl]phenoxy]acetic acid is CC(C)(NCC(O)COc1cccc(N)c1N)c1ccc(OCC(=O)O)cc1.
What is the InChIKey of 2-[4-[2-[[3-(2,3-diaminophenoxy)-2-hydroxypropyl]amino]propan-2-yl]phenoxy]acetic acid?
The InChIKey is QQVUQROHEHRVQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N3O5/c1-20(2,13-6-8-15(9-7-13)27-12-18(25)26)23-10-14(24)11-28-17-5-3-4-16(21)19(17)22/h3-9,14,23-24H,10-12,21-22H2,1-2H3,(H,25,26).
What are the key properties of 2-[4-[2-[[3-(2,3-diaminophenoxy)-2-hydroxypropyl]amino]propan-2-yl]phenoxy]acetic acid?
2-[4-[2-[[3-(2,3-diaminophenoxy)-2-hydroxypropyl]amino]propan-2-yl]phenoxy]acetic acid has a molecular weight of 389.45 g/mol, XLogP of 1.58, 10 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-[[3-(2,3-diaminophenoxy)-2-hydroxypropyl]amino]propan-2-yl]phenoxy]acetic acid is sourced from PubChem (CID 67763614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).