C10H21NO4 — CID 67764109
1,2-bis(dimethoxymethyl)pyrrolidine (PubChem CID 67764109) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is 1,2-bis(dimethoxymethyl)pyrrolidine.
| Compound Name | 1,2-bis(dimethoxymethyl)pyrrolidine |
|---|---|
| PubChem CID | 67764109 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 1,2-bis(dimethoxymethyl)pyrrolidine |
| SMILES | COC(OC)C1CCCN1C(OC)OC |
| InChI | InChI=1S/C10H21NO4/c1-12-9(13-2)8-6-5-7-11(8)10(14-3)15-4/h8-10H,5-7H2,1-4H3 |
| InChIKey | LWPOGICJIZVSPT-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|