C25H50O7Si4 — CID 67764245
2-cyclohexyl-3-[1-[2,6,6-trimethyl-2,3-bis(trimethylsilyloxy)oxadisilinan-3-yl]propyl]but-2-enedioic acid (PubChem CID 67764245) has the molecular formula C25H50O7Si4 and a molecular weight of 575.01 g/mol. Its IUPAC name is 2-cyclohexyl-3-[1-[2,6,6-trimethyl-2,3-bis(trimethylsilyloxy)oxadisilinan-3-yl]propyl]but-2-enedioic acid.
| Compound Name | 2-cyclohexyl-3-[1-[2,6,6-trimethyl-2,3-bis(trimethylsilyloxy)oxadisilinan-3-yl]propyl]but-2-enedioic acid |
|---|---|
| PubChem CID | 67764245 |
| Molecular Formula | C25H50O7Si4 |
| Molecular Weight | 575.01 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | 2-cyclohexyl-3-[1-[2,6,6-trimethyl-2,3-bis(trimethylsilyloxy)oxadisilinan-3-yl]propyl]but-2-enedioic acid |
| SMILES | CCC(C(C(=O)O)=C(C(=O)O)C1CCCCC1)[Si]1(O[Si](C)(C)C)CCC(C)(C)O[Si]1(C)O[Si](C)(C)C |
| InChI | InChI=1S/C25H50O7Si4/c1-11-20(22(24(28)29)21(23(26)27)19-15-13-12-14-16-19)36(32-34(7,8)9)18-17-25(2,3)30-35(36,10)31-33(4,5)6/h19-20H,11-18H2,1-10H3,(H,26,27)(H,28,29) |
| InChIKey | JLSMDNMOGRSKRS-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.01 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|