About [6-[2-(3,4-diethoxy-2-prop-2-enoyloxyphenyl)propan-2-yl]-2,3-diethoxyphenyl] prop-2-enoate
[6-[2-(3,4-diethoxy-2-prop-2-enoyloxyphenyl)propan-2-yl]-2,3-diethoxyphenyl] prop-2-enoate (PubChem CID 67764266) has the molecular formula C29H36O8
and a molecular weight of 512.60 g/mol. Its IUPAC name is [6-[2-(3,4-diethoxy-2-prop-2-enoyloxyphenyl)propan-2-yl]-2,3-diethoxyphenyl] prop-2-enoate.
Molecular Properties
| Compound Name | [6-[2-(3,4-diethoxy-2-prop-2-enoyloxyphenyl)propan-2-yl]-2,3-diethoxyphenyl] prop-2-enoate |
| PubChem CID | 67764266 |
| Molecular Formula | C29H36O8 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | [6-[2-(3,4-diethoxy-2-prop-2-enoyloxyphenyl)propan-2-yl]-2,3-diethoxyphenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1c(C(C)(C)c2ccc(OCC)c(OCC)c2OC(=O)C=C)ccc(OCC)c1OCC |
| InChI | InChI=1S/C29H36O8/c1-9-23(30)36-25-19(15-17-21(32-11-3)27(25)34-13-5)29(7,8)20-16-18-22(33-12-4)28(35-14-6)26(20)37-24(31)10-2/h9-10,15-18H,1-2,11-14H2,3-8H3 |
| InChIKey | GTNZMLVEQSTEDV-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [6-[2-(3,4-diethoxy-2-prop-2-enoyloxyphenyl)propan-2-yl]-2,3-diethoxyphenyl] prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[2-(3,4-diethoxy-2-prop-2-enoyloxyphenyl)propan-2-yl]-2,3-diethoxyphenyl] prop-2-enoate?
The IUPAC name of [6-[2-(3,4-diethoxy-2-prop-2-enoyloxyphenyl)propan-2-yl]-2,3-diethoxyphenyl] prop-2-enoate (CID 67764266) is [6-[2-(3,4-diethoxy-2-prop-2-enoyloxyphenyl)propan-2-yl]-2,3-diethoxyphenyl] prop-2-enoate.
What is the SMILES notation for [6-[2-(3,4-diethoxy-2-prop-2-enoyloxyphenyl)propan-2-yl]-2,3-diethoxyphenyl] prop-2-enoate?
The canonical SMILES for [6-[2-(3,4-diethoxy-2-prop-2-enoyloxyphenyl)propan-2-yl]-2,3-diethoxyphenyl] prop-2-enoate is C=CC(=O)Oc1c(C(C)(C)c2ccc(OCC)c(OCC)c2OC(=O)C=C)ccc(OCC)c1OCC.
What is the InChIKey of [6-[2-(3,4-diethoxy-2-prop-2-enoyloxyphenyl)propan-2-yl]-2,3-diethoxyphenyl] prop-2-enoate?
The InChIKey is GTNZMLVEQSTEDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H36O8/c1-9-23(30)36-25-19(15-17-21(32-11-3)27(25)34-13-5)29(7,8)20-16-18-22(33-12-4)28(35-14-6)26(20)37-24(31)10-2/h9-10,15-18H,1-2,11-14H2,3-8H3.
What are the key properties of [6-[2-(3,4-diethoxy-2-prop-2-enoyloxyphenyl)propan-2-yl]-2,3-diethoxyphenyl] prop-2-enoate?
[6-[2-(3,4-diethoxy-2-prop-2-enoyloxyphenyl)propan-2-yl]-2,3-diethoxyphenyl] prop-2-enoate has a molecular weight of 512.60 g/mol, XLogP of 5.79, 14 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[2-(3,4-diethoxy-2-prop-2-enoyloxyphenyl)propan-2-yl]-2,3-diethoxyphenyl] prop-2-enoate is sourced from PubChem (CID 67764266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).