C16H15FN2O4 — CID 67764305
3-(6-fluoro-3-pyridinyl)-7,7-dimethyl-5,6-dihydropyrrolizine-1,2-dicarboxylic acid (PubChem CID 67764305) has the molecular formula C16H15FN2O4 and a molecular weight of 318.30 g/mol. Its IUPAC name is 3-(6-fluoro-3-pyridinyl)-7,7-dimethyl-5,6-dihydropyrrolizine-1,2-dicarboxylic acid.
| Compound Name | 3-(6-fluoro-3-pyridinyl)-7,7-dimethyl-5,6-dihydropyrrolizine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 67764305 |
| Molecular Formula | C16H15FN2O4 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 3-(6-fluoro-3-pyridinyl)-7,7-dimethyl-5,6-dihydropyrrolizine-1,2-dicarboxylic acid |
| SMILES | CC1(C)CCn2c(-c3ccc(F)nc3)c(C(=O)O)c(C(=O)O)c21 |
| InChI | InChI=1S/C16H15FN2O4/c1-16(2)5-6-19-12(8-3-4-9(17)18-7-8)10(14(20)21)11(13(16)19)15(22)23/h3-4,7H,5-6H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | NVQOSMSUHHOKJW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|