C23H44O6Si3 — CID 67764315
2-cyclohexyl-3-[1-(2,2,6,6-tetramethyl-3-trimethylsilyloxyoxadisilinan-3-yl)propyl]but-2-enedioic acid (PubChem CID 67764315) has the molecular formula C23H44O6Si3 and a molecular weight of 500.86 g/mol. Its IUPAC name is 2-cyclohexyl-3-[1-(2,2,6,6-tetramethyl-3-trimethylsilyloxyoxadisilinan-3-yl)propyl]but-2-enedioic acid.
| Compound Name | 2-cyclohexyl-3-[1-(2,2,6,6-tetramethyl-3-trimethylsilyloxyoxadisilinan-3-yl)propyl]but-2-enedioic acid |
|---|---|
| PubChem CID | 67764315 |
| Molecular Formula | C23H44O6Si3 |
| Molecular Weight | 500.86 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 2-cyclohexyl-3-[1-(2,2,6,6-tetramethyl-3-trimethylsilyloxyoxadisilinan-3-yl)propyl]but-2-enedioic acid |
| SMILES | CCC(C(C(=O)O)=C(C(=O)O)C1CCCCC1)[Si]1(O[Si](C)(C)C)CCC(C)(C)O[Si]1(C)C |
| InChI | InChI=1S/C23H44O6Si3/c1-9-18(20(22(26)27)19(21(24)25)17-13-11-10-12-14-17)32(29-30(4,5)6)16-15-23(2,3)28-31(32,7)8/h17-18H,9-16H2,1-8H3,(H,24,25)(H,26,27) |
| InChIKey | UAMKMBNMBBTDFP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.86 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|