About 2,4-dichloro-1-ethenylbenzene;styrene
2,4-dichloro-1-ethenylbenzene;styrene (PubChem CID 67764431) has the molecular formula C16H14Cl2
and a molecular weight of 277.19 g/mol. Its IUPAC name is 2,4-dichloro-1-ethenylbenzene;styrene.
Molecular Properties
| Compound Name | 2,4-dichloro-1-ethenylbenzene;styrene |
| PubChem CID | 67764431 |
| Molecular Formula | C16H14Cl2 |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 2,4-dichloro-1-ethenylbenzene;styrene |
| SMILES | C=Cc1ccc(Cl)cc1Cl.C=Cc1ccccc1 |
| InChI | InChI=1S/C8H6Cl2.C8H8/c1-2-6-3-4-7(9)5-8(6)10;1-2-8-6-4-3-5-7-8/h2-5H,1H2;2-7H,1H2 |
| InChIKey | ZAESNNURWMFWOL-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,4-dichloro-1-ethenylbenzene;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-1-ethenylbenzene;styrene?
The IUPAC name of 2,4-dichloro-1-ethenylbenzene;styrene (CID 67764431) is 2,4-dichloro-1-ethenylbenzene;styrene.
What is the SMILES notation for 2,4-dichloro-1-ethenylbenzene;styrene?
The canonical SMILES for 2,4-dichloro-1-ethenylbenzene;styrene is C=Cc1ccc(Cl)cc1Cl.C=Cc1ccccc1.
What is the InChIKey of 2,4-dichloro-1-ethenylbenzene;styrene?
The InChIKey is ZAESNNURWMFWOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl2.C8H8/c1-2-6-3-4-7(9)5-8(6)10;1-2-8-6-4-3-5-7-8/h2-5H,1H2;2-7H,1H2.
What are the key properties of 2,4-dichloro-1-ethenylbenzene;styrene?
2,4-dichloro-1-ethenylbenzene;styrene has a molecular weight of 277.19 g/mol, XLogP of 5.97, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-1-ethenylbenzene;styrene is sourced from PubChem (CID 67764431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).