About 1-(2-piperazin-1-ylethyl)piperazine;1-(1-piperazin-1-ylpropan-2-yl)piperazine
1-(2-piperazin-1-ylethyl)piperazine;1-(1-piperazin-1-ylpropan-2-yl)piperazine (PubChem CID 67764532) has the molecular formula C21H46N8
and a molecular weight of 410.66 g/mol. Its IUPAC name is 1-(2-piperazin-1-ylethyl)piperazine;1-(1-piperazin-1-ylpropan-2-yl)piperazine.
Molecular Properties
| Compound Name | 1-(2-piperazin-1-ylethyl)piperazine;1-(1-piperazin-1-ylpropan-2-yl)piperazine |
| PubChem CID | 67764532 |
| Molecular Formula | C21H46N8 |
| Molecular Weight | 410.66 g/mol |
| Exact Mass | 410.38 |
| IUPAC Name | 1-(2-piperazin-1-ylethyl)piperazine;1-(1-piperazin-1-ylpropan-2-yl)piperazine |
| SMILES | C1CN(CCN2CCNCC2)CCN1.CC(CN1CCNCC1)N1CCNCC1 |
| InChI | InChI=1S/C11H24N4.C10H22N4/c1-11(15-8-4-13-5-9-15)10-14-6-2-12-3-7-14;1-5-13(6-2-11-1)9-10-14-7-3-12-4-8-14/h11-13H,2-10H2,1H3;11-12H,1-10H2 |
| InChIKey | GSFOIXYUAZBAMD-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.66 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-(2-piperazin-1-ylethyl)piperazine;1-(1-piperazin-1-ylpropan-2-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-piperazin-1-ylethyl)piperazine;1-(1-piperazin-1-ylpropan-2-yl)piperazine?
The IUPAC name of 1-(2-piperazin-1-ylethyl)piperazine;1-(1-piperazin-1-ylpropan-2-yl)piperazine (CID 67764532) is 1-(2-piperazin-1-ylethyl)piperazine;1-(1-piperazin-1-ylpropan-2-yl)piperazine.
What is the SMILES notation for 1-(2-piperazin-1-ylethyl)piperazine;1-(1-piperazin-1-ylpropan-2-yl)piperazine?
The canonical SMILES for 1-(2-piperazin-1-ylethyl)piperazine;1-(1-piperazin-1-ylpropan-2-yl)piperazine is C1CN(CCN2CCNCC2)CCN1.CC(CN1CCNCC1)N1CCNCC1.
What is the InChIKey of 1-(2-piperazin-1-ylethyl)piperazine;1-(1-piperazin-1-ylpropan-2-yl)piperazine?
The InChIKey is GSFOIXYUAZBAMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N4.C10H22N4/c1-11(15-8-4-13-5-9-15)10-14-6-2-12-3-7-14;1-5-13(6-2-11-1)9-10-14-7-3-12-4-8-14/h11-13H,2-10H2,1H3;11-12H,1-10H2.
What are the key properties of 1-(2-piperazin-1-ylethyl)piperazine;1-(1-piperazin-1-ylpropan-2-yl)piperazine?
1-(2-piperazin-1-ylethyl)piperazine;1-(1-piperazin-1-ylpropan-2-yl)piperazine has a molecular weight of 410.66 g/mol, XLogP of -2.02, 6 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-piperazin-1-ylethyl)piperazine;1-(1-piperazin-1-ylpropan-2-yl)piperazine is sourced from PubChem (CID 67764532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).