About 1-pentoxy-2,3-dihydroinden-1-amine
1-pentoxy-2,3-dihydroinden-1-amine (PubChem CID 67764672) has the molecular formula C14H21NO
and a molecular weight of 219.33 g/mol. Its IUPAC name is 1-pentoxy-2,3-dihydroinden-1-amine.
Molecular Properties
| Compound Name | 1-pentoxy-2,3-dihydroinden-1-amine |
| PubChem CID | 67764672 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 1-pentoxy-2,3-dihydroinden-1-amine |
| SMILES | CCCCCOC1(N)CCc2ccccc21 |
| InChI | InChI=1S/C14H21NO/c1-2-3-6-11-16-14(15)10-9-12-7-4-5-8-13(12)14/h4-5,7-8H,2-3,6,9-11,15H2,1H3 |
| InChIKey | KNLZWPUIYGRHLH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-pentoxy-2,3-dihydroinden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentoxy-2,3-dihydroinden-1-amine?
The IUPAC name of 1-pentoxy-2,3-dihydroinden-1-amine (CID 67764672) is 1-pentoxy-2,3-dihydroinden-1-amine.
What is the SMILES notation for 1-pentoxy-2,3-dihydroinden-1-amine?
The canonical SMILES for 1-pentoxy-2,3-dihydroinden-1-amine is CCCCCOC1(N)CCc2ccccc21.
What is the InChIKey of 1-pentoxy-2,3-dihydroinden-1-amine?
The InChIKey is KNLZWPUIYGRHLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO/c1-2-3-6-11-16-14(15)10-9-12-7-4-5-8-13(12)14/h4-5,7-8H,2-3,6,9-11,15H2,1H3.
What are the key properties of 1-pentoxy-2,3-dihydroinden-1-amine?
1-pentoxy-2,3-dihydroinden-1-amine has a molecular weight of 219.33 g/mol, XLogP of 2.95, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentoxy-2,3-dihydroinden-1-amine is sourced from PubChem (CID 67764672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).