About 1,3-dihydroxypropan-2-yl acetate;oxepan-2-one
1,3-dihydroxypropan-2-yl acetate;oxepan-2-one (PubChem CID 67764687) has the molecular formula C11H20O6
and a molecular weight of 248.27 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl acetate;oxepan-2-one.
Molecular Properties
| Compound Name | 1,3-dihydroxypropan-2-yl acetate;oxepan-2-one |
| PubChem CID | 67764687 |
| Molecular Formula | C11H20O6 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl acetate;oxepan-2-one |
| SMILES | CC(=O)OC(CO)CO.O=C1CCCCCO1 |
| InChI | InChI=1S/C6H10O2.C5H10O4/c7-6-4-2-1-3-5-8-6;1-4(8)9-5(2-6)3-7/h1-5H2;5-7H,2-3H2,1H3 |
| InChIKey | PWGDXIMZENIYAE-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,3-dihydroxypropan-2-yl acetate;oxepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dihydroxypropan-2-yl acetate;oxepan-2-one?
The IUPAC name of 1,3-dihydroxypropan-2-yl acetate;oxepan-2-one (CID 67764687) is 1,3-dihydroxypropan-2-yl acetate;oxepan-2-one.
What is the SMILES notation for 1,3-dihydroxypropan-2-yl acetate;oxepan-2-one?
The canonical SMILES for 1,3-dihydroxypropan-2-yl acetate;oxepan-2-one is CC(=O)OC(CO)CO.O=C1CCCCCO1.
What is the InChIKey of 1,3-dihydroxypropan-2-yl acetate;oxepan-2-one?
The InChIKey is PWGDXIMZENIYAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.C5H10O4/c7-6-4-2-1-3-5-8-6;1-4(8)9-5(2-6)3-7/h1-5H2;5-7H,2-3H2,1H3.
What are the key properties of 1,3-dihydroxypropan-2-yl acetate;oxepan-2-one?
1,3-dihydroxypropan-2-yl acetate;oxepan-2-one has a molecular weight of 248.27 g/mol, XLogP of 0.01, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dihydroxypropan-2-yl acetate;oxepan-2-one is sourced from PubChem (CID 67764687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).