C17H13NO6S — CID 67764766
4-[hydroxy-(2-methyl-1,1,4-trioxo-1λ6,2-benzothiazin-3-ylidene)methyl]benzoic acid (PubChem CID 67764766) has the molecular formula C17H13NO6S and a molecular weight of 359.36 g/mol. Its IUPAC name is 4-[hydroxy-(2-methyl-1,1,4-trioxo-1λ6,2-benzothiazin-3-ylidene)methyl]benzoic acid.
| Compound Name | 4-[hydroxy-(2-methyl-1,1,4-trioxo-1λ6,2-benzothiazin-3-ylidene)methyl]benzoic acid |
|---|---|
| PubChem CID | 67764766 |
| Molecular Formula | C17H13NO6S |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 4-[hydroxy-(2-methyl-1,1,4-trioxo-1λ6,2-benzothiazin-3-ylidene)methyl]benzoic acid |
| SMILES | CN1C(=C(O)c2ccc(C(=O)O)cc2)C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C17H13NO6S/c1-18-14(15(19)10-6-8-11(9-7-10)17(21)22)16(20)12-4-2-3-5-13(12)25(18,23)24/h2-9,19H,1H3,(H,21,22) |
| InChIKey | JMLNFFCNRTXAIP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|