C36H43FN4O7 — CID 67764913
(Z)-but-2-enedioic acid;2-[2-[4-(1-decanoyl-6-fluoroindazol-3-yl)piperidin-1-yl]ethyl]isoindole-1,3-dione (PubChem CID 67764913) has the molecular formula C36H43FN4O7 and a molecular weight of 662.76 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;2-[2-[4-(1-decanoyl-6-fluoroindazol-3-yl)piperidin-1-yl]ethyl]isoindole-1,3-dione.
| Compound Name | (Z)-but-2-enedioic acid;2-[2-[4-(1-decanoyl-6-fluoroindazol-3-yl)piperidin-1-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67764913 |
| Molecular Formula | C36H43FN4O7 |
| Molecular Weight | 662.76 g/mol |
| Exact Mass | 662.31 |
| IUPAC Name | (Z)-but-2-enedioic acid;2-[2-[4-(1-decanoyl-6-fluoroindazol-3-yl)piperidin-1-yl]ethyl]isoindole-1,3-dione |
| SMILES | CCCCCCCCCC(=O)n1nc(C2CCN(CCN3C(=O)c4ccccc4C3=O)CC2)c2ccc(F)cc21.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C32H39FN4O3.C4H4O4/c1-2-3-4-5-6-7-8-13-29(38)37-28-22-24(33)14-15-27(28)30(34-37)23-16-18-35(19-17-23)20-21-36-31(39)25-11-9-10-12-26(25)32(36)40;5-3(6)1-2-4(7)8/h9-12,14-15,22-23H,2-8,13,16-21H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | SUMDRLWYPSQTKS-BTJKTKAUSA-N |
| XLogP | 6.14 |
| TPSA | 150.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.76 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|