About 4-cyclohexa-2,4-dien-1-yl-1-methyl-2H-pyrrol-5-one
4-cyclohexa-2,4-dien-1-yl-1-methyl-2H-pyrrol-5-one (PubChem CID 67764983) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 4-cyclohexa-2,4-dien-1-yl-1-methyl-2H-pyrrol-5-one.
Molecular Properties
| Compound Name | 4-cyclohexa-2,4-dien-1-yl-1-methyl-2H-pyrrol-5-one |
| PubChem CID | 67764983 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 4-cyclohexa-2,4-dien-1-yl-1-methyl-2H-pyrrol-5-one |
| SMILES | CN1CC=C(C2C=CC=CC2)C1=O |
| InChI | InChI=1S/C11H13NO/c1-12-8-7-10(11(12)13)9-5-3-2-4-6-9/h2-5,7,9H,6,8H2,1H3 |
| InChIKey | OZEHYCDXVKBPDE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-cyclohexa-2,4-dien-1-yl-1-methyl-2H-pyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexa-2,4-dien-1-yl-1-methyl-2H-pyrrol-5-one?
The IUPAC name of 4-cyclohexa-2,4-dien-1-yl-1-methyl-2H-pyrrol-5-one (CID 67764983) is 4-cyclohexa-2,4-dien-1-yl-1-methyl-2H-pyrrol-5-one.
What is the SMILES notation for 4-cyclohexa-2,4-dien-1-yl-1-methyl-2H-pyrrol-5-one?
The canonical SMILES for 4-cyclohexa-2,4-dien-1-yl-1-methyl-2H-pyrrol-5-one is CN1CC=C(C2C=CC=CC2)C1=O.
What is the InChIKey of 4-cyclohexa-2,4-dien-1-yl-1-methyl-2H-pyrrol-5-one?
The InChIKey is OZEHYCDXVKBPDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c1-12-8-7-10(11(12)13)9-5-3-2-4-6-9/h2-5,7,9H,6,8H2,1H3.
What are the key properties of 4-cyclohexa-2,4-dien-1-yl-1-methyl-2H-pyrrol-5-one?
4-cyclohexa-2,4-dien-1-yl-1-methyl-2H-pyrrol-5-one has a molecular weight of 175.23 g/mol, XLogP of 1.52, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexa-2,4-dien-1-yl-1-methyl-2H-pyrrol-5-one is sourced from PubChem (CID 67764983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).