C15H24O2 — CID 67765220
(2E,6E,8S,9S,10R)-8-methoxy-9,10-dimethylcyclododeca-2,6-dien-1-one (PubChem CID 67765220) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (2E,6E,8S,9S,10R)-8-methoxy-9,10-dimethylcyclododeca-2,6-dien-1-one.
| Compound Name | (2E,6E,8S,9S,10R)-8-methoxy-9,10-dimethylcyclododeca-2,6-dien-1-one |
|---|---|
| PubChem CID | 67765220 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (2E,6E,8S,9S,10R)-8-methoxy-9,10-dimethylcyclododeca-2,6-dien-1-one |
| SMILES | CO[C@H]1/C=C/CC/C=C/C(=O)CC[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C15H24O2/c1-12-10-11-14(16)8-6-4-5-7-9-15(17-3)13(12)2/h6-9,12-13,15H,4-5,10-11H2,1-3H3/b8-6+,9-7+/t12-,13+,15+/m1/s1 |
| InChIKey | JATFICVFOTWLOW-ZQWRQMRDSA-N |
| XLogP | 3.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|