About (2R)-1-(4-fluorocyclohexa-1,5-dien-1-yl)propan-2-ol
(2R)-1-(4-fluorocyclohexa-1,5-dien-1-yl)propan-2-ol (PubChem CID 67765367) has the molecular formula C9H13FO
and a molecular weight of 156.20 g/mol. Its IUPAC name is (2R)-1-(4-fluorocyclohexa-1,5-dien-1-yl)propan-2-ol.
Molecular Properties
| Compound Name | (2R)-1-(4-fluorocyclohexa-1,5-dien-1-yl)propan-2-ol |
| PubChem CID | 67765367 |
| Molecular Formula | C9H13FO |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | (2R)-1-(4-fluorocyclohexa-1,5-dien-1-yl)propan-2-ol |
| SMILES | C[C@@H](O)CC1=CCC(F)C=C1 |
| InChI | InChI=1S/C9H13FO/c1-7(11)6-8-2-4-9(10)5-3-8/h2-4,7,9,11H,5-6H2,1H3/t7-,9?/m1/s1 |
| InChIKey | WKGKLPDLQKOJGH-YOXFSPIKSA-N |
| XLogP | 1.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-1-(4-fluorocyclohexa-1,5-dien-1-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-(4-fluorocyclohexa-1,5-dien-1-yl)propan-2-ol?
The IUPAC name of (2R)-1-(4-fluorocyclohexa-1,5-dien-1-yl)propan-2-ol (CID 67765367) is (2R)-1-(4-fluorocyclohexa-1,5-dien-1-yl)propan-2-ol.
What is the SMILES notation for (2R)-1-(4-fluorocyclohexa-1,5-dien-1-yl)propan-2-ol?
The canonical SMILES for (2R)-1-(4-fluorocyclohexa-1,5-dien-1-yl)propan-2-ol is C[C@@H](O)CC1=CCC(F)C=C1.
What is the InChIKey of (2R)-1-(4-fluorocyclohexa-1,5-dien-1-yl)propan-2-ol?
The InChIKey is WKGKLPDLQKOJGH-YOXFSPIKSA-N. The full InChI is InChI=1S/C9H13FO/c1-7(11)6-8-2-4-9(10)5-3-8/h2-4,7,9,11H,5-6H2,1H3/t7-,9?/m1/s1.
What are the key properties of (2R)-1-(4-fluorocyclohexa-1,5-dien-1-yl)propan-2-ol?
(2R)-1-(4-fluorocyclohexa-1,5-dien-1-yl)propan-2-ol has a molecular weight of 156.20 g/mol, XLogP of 1.98, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-(4-fluorocyclohexa-1,5-dien-1-yl)propan-2-ol is sourced from PubChem (CID 67765367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).