About 2-methyl-1,3-thiazole-5-sulfinate
2-methyl-1,3-thiazole-5-sulfinate (PubChem CID 67765382) has the molecular formula C4H4NO2S2-
and a molecular weight of 162.22 g/mol. Its IUPAC name is 2-methyl-1,3-thiazole-5-sulfinate.
Molecular Properties
| Compound Name | 2-methyl-1,3-thiazole-5-sulfinate |
| PubChem CID | 67765382 |
| Molecular Formula | C4H4NO2S2- |
| Molecular Weight | 162.22 g/mol |
| Exact Mass | 161.97 |
| IUPAC Name | 2-methyl-1,3-thiazole-5-sulfinate |
| SMILES | Cc1ncc(S(=O)[O-])s1 |
| InChI | InChI=1S/C4H5NO2S2/c1-3-5-2-4(8-3)9(6)7/h2H,1H3,(H,6,7)/p-1 |
| InChIKey | KLQNXQZKKPJLKR-UHFFFAOYSA-M |
| XLogP | 0.69 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1,3-thiazole-5-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,3-thiazole-5-sulfinate?
The IUPAC name of 2-methyl-1,3-thiazole-5-sulfinate (CID 67765382) is 2-methyl-1,3-thiazole-5-sulfinate.
What is the SMILES notation for 2-methyl-1,3-thiazole-5-sulfinate?
The canonical SMILES for 2-methyl-1,3-thiazole-5-sulfinate is Cc1ncc(S(=O)[O-])s1.
What is the InChIKey of 2-methyl-1,3-thiazole-5-sulfinate?
The InChIKey is KLQNXQZKKPJLKR-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H5NO2S2/c1-3-5-2-4(8-3)9(6)7/h2H,1H3,(H,6,7)/p-1.
What are the key properties of 2-methyl-1,3-thiazole-5-sulfinate?
2-methyl-1,3-thiazole-5-sulfinate has a molecular weight of 162.22 g/mol, XLogP of 0.69, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,3-thiazole-5-sulfinate is sourced from PubChem (CID 67765382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).