C28H35F3N6O4S — CID 67766264
(2S)-N-[(1-methanehydrazonoylpiperidin-4-yl)methyl]-1-[(2R)-3-phenyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoyl]pyrrolidine-2-carboxamide (PubChem CID 67766264) has the molecular formula C28H35F3N6O4S and a molecular weight of 608.69 g/mol. Its IUPAC name is (2S)-N-[(1-methanehydrazonoylpiperidin-4-yl)methyl]-1-[(2R)-3-phenyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(1-methanehydrazonoylpiperidin-4-yl)methyl]-1-[(2R)-3-phenyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 67766264 |
| Molecular Formula | C28H35F3N6O4S |
| Molecular Weight | 608.69 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | (2S)-N-[(1-methanehydrazonoylpiperidin-4-yl)methyl]-1-[(2R)-3-phenyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoyl]pyrrolidine-2-carboxamide |
| SMILES | NN=CN1CCC(CNC(=O)[C@@H]2CCCN2C(=O)[C@@H](Cc2ccccc2)NS(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C28H35F3N6O4S/c29-28(30,31)22-8-4-9-23(17-22)42(40,41)35-24(16-20-6-2-1-3-7-20)27(39)37-13-5-10-25(37)26(38)33-18-21-11-14-36(15-12-21)19-34-32/h1-4,6-9,17,19,21,24-25,35H,5,10-16,18,32H2,(H,33,38)/t24-,25+/m1/s1 |
| InChIKey | KTIXBUYOKCXXMQ-RPBOFIJWSA-N |
| XLogP | 2.32 |
| TPSA | 137.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.69 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|