About 1-methyl-1,3-diphenylthiourea
1-methyl-1,3-diphenylthiourea (PubChem CID 677665) has the molecular formula C14H14N2S
and a molecular weight of 242.35 g/mol. Its IUPAC name is 1-methyl-1,3-diphenylthiourea.
Molecular Properties
| Compound Name | 1-methyl-1,3-diphenylthiourea |
| PubChem CID | 677665 |
| Molecular Formula | C14H14N2S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 1-methyl-1,3-diphenylthiourea |
| SMILES | CN(C(=S)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H14N2S/c1-16(13-10-6-3-7-11-13)14(17)15-12-8-4-2-5-9-12/h2-11H,1H3,(H,15,17) |
| InChIKey | WFICXIZBSZGSGV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-1,3-diphenylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1,3-diphenylthiourea?
The IUPAC name of 1-methyl-1,3-diphenylthiourea (CID 677665) is 1-methyl-1,3-diphenylthiourea.
What is the SMILES notation for 1-methyl-1,3-diphenylthiourea?
The canonical SMILES for 1-methyl-1,3-diphenylthiourea is CN(C(=S)Nc1ccccc1)c1ccccc1.
What is the InChIKey of 1-methyl-1,3-diphenylthiourea?
The InChIKey is WFICXIZBSZGSGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2S/c1-16(13-10-6-3-7-11-13)14(17)15-12-8-4-2-5-9-12/h2-11H,1H3,(H,15,17).
What are the key properties of 1-methyl-1,3-diphenylthiourea?
1-methyl-1,3-diphenylthiourea has a molecular weight of 242.35 g/mol, XLogP of 3.52, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1,3-diphenylthiourea is sourced from PubChem (CID 677665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).