About 2-(2-ethoxyethoxy)ethanol;2-phenylethylbenzene
2-(2-ethoxyethoxy)ethanol;2-phenylethylbenzene (PubChem CID 67767240) has the molecular formula C20H28O3
and a molecular weight of 316.44 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)ethanol;2-phenylethylbenzene.
Molecular Properties
| Compound Name | 2-(2-ethoxyethoxy)ethanol;2-phenylethylbenzene |
| PubChem CID | 67767240 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 2-(2-ethoxyethoxy)ethanol;2-phenylethylbenzene |
| SMILES | CCOCCOCCO.c1ccc(CCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14.C6H14O3/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-2-8-5-6-9-4-3-7/h1-10H,11-12H2;7H,2-6H2,1H3 |
| InChIKey | REBKSDNFLZSPPY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-ethoxyethoxy)ethanol;2-phenylethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethoxyethoxy)ethanol;2-phenylethylbenzene?
The IUPAC name of 2-(2-ethoxyethoxy)ethanol;2-phenylethylbenzene (CID 67767240) is 2-(2-ethoxyethoxy)ethanol;2-phenylethylbenzene.
What is the SMILES notation for 2-(2-ethoxyethoxy)ethanol;2-phenylethylbenzene?
The canonical SMILES for 2-(2-ethoxyethoxy)ethanol;2-phenylethylbenzene is CCOCCOCCO.c1ccc(CCc2ccccc2)cc1.
What is the InChIKey of 2-(2-ethoxyethoxy)ethanol;2-phenylethylbenzene?
The InChIKey is REBKSDNFLZSPPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.C6H14O3/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-2-8-5-6-9-4-3-7/h1-10H,11-12H2;7H,2-6H2,1H3.
What are the key properties of 2-(2-ethoxyethoxy)ethanol;2-phenylethylbenzene?
2-(2-ethoxyethoxy)ethanol;2-phenylethylbenzene has a molecular weight of 316.44 g/mol, XLogP of 3.50, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethoxyethoxy)ethanol;2-phenylethylbenzene is sourced from PubChem (CID 67767240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).