About 3H-cyclopenta[c][1,5]benzodiazepin-4-one
3H-cyclopenta[c][1,5]benzodiazepin-4-one (PubChem CID 67767526) has the molecular formula C12H8N2O
and a molecular weight of 196.21 g/mol. Its IUPAC name is 3H-cyclopenta[c][1,5]benzodiazepin-4-one.
Molecular Properties
| Compound Name | 3H-cyclopenta[c][1,5]benzodiazepin-4-one |
| PubChem CID | 67767526 |
| Molecular Formula | C12H8N2O |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 3H-cyclopenta[c][1,5]benzodiazepin-4-one |
| SMILES | O=c1nc2ccccc2nc2c1CC=C2 |
| InChI | InChI=1S/C12H8N2O/c15-12-8-4-3-7-9(8)13-10-5-1-2-6-11(10)14-12/h1-3,5-7H,4H2 |
| InChIKey | UHGOGIROJPHELX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3H-cyclopenta[c][1,5]benzodiazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-cyclopenta[c][1,5]benzodiazepin-4-one?
The IUPAC name of 3H-cyclopenta[c][1,5]benzodiazepin-4-one (CID 67767526) is 3H-cyclopenta[c][1,5]benzodiazepin-4-one.
What is the SMILES notation for 3H-cyclopenta[c][1,5]benzodiazepin-4-one?
The canonical SMILES for 3H-cyclopenta[c][1,5]benzodiazepin-4-one is O=c1nc2ccccc2nc2c1CC=C2.
What is the InChIKey of 3H-cyclopenta[c][1,5]benzodiazepin-4-one?
The InChIKey is UHGOGIROJPHELX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O/c15-12-8-4-3-7-9(8)13-10-5-1-2-6-11(10)14-12/h1-3,5-7H,4H2.
What are the key properties of 3H-cyclopenta[c][1,5]benzodiazepin-4-one?
3H-cyclopenta[c][1,5]benzodiazepin-4-one has a molecular weight of 196.21 g/mol, XLogP of 1.56, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-cyclopenta[c][1,5]benzodiazepin-4-one is sourced from PubChem (CID 67767526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).