C19H29BrO2 — CID 67768221
(7S,8S,9S,10S,13S,14S)-7-bromo-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-1,1-diol (PubChem CID 67768221) has the molecular formula C19H29BrO2 and a molecular weight of 369.34 g/mol. Its IUPAC name is (7S,8S,9S,10S,13S,14S)-7-bromo-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-1,1-diol.
| Compound Name | (7S,8S,9S,10S,13S,14S)-7-bromo-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-1,1-diol |
|---|---|
| PubChem CID | 67768221 |
| Molecular Formula | C19H29BrO2 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (7S,8S,9S,10S,13S,14S)-7-bromo-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-1,1-diol |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1[C@@H](Br)CC3CC=CC(O)(O)[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C19H29BrO2/c1-17-8-4-6-13(17)16-14(7-10-17)18(2)12(11-15(16)20)5-3-9-19(18,21)22/h3,9,12-16,21-22H,4-8,10-11H2,1-2H3/t12?,13-,14-,15-,16-,17-,18-/m0/s1 |
| InChIKey | JKRFNMDDBKBRHY-UREASMCTSA-N |
| XLogP | 4.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|