C32H34O12 — CID 67768305
diethyl (4R,5R)-2-[4-[2-[4-[(4R,5R)-4,5-bis(ethoxycarbonyl)-1,3-dioxolan-2-yl]phenyl]ethynyl]phenyl]-1,3-dioxolane-4,5-dicarboxylate (PubChem CID 67768305) has the molecular formula C32H34O12 and a molecular weight of 610.61 g/mol. Its IUPAC name is diethyl (4R,5R)-2-[4-[2-[4-[(4R,5R)-4,5-bis(ethoxycarbonyl)-1,3-dioxolan-2-yl]phenyl]ethynyl]phenyl]-1,3-dioxolane-4,5-dicarboxylate.
| Compound Name | diethyl (4R,5R)-2-[4-[2-[4-[(4R,5R)-4,5-bis(ethoxycarbonyl)-1,3-dioxolan-2-yl]phenyl]ethynyl]phenyl]-1,3-dioxolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 67768305 |
| Molecular Formula | C32H34O12 |
| Molecular Weight | 610.61 g/mol |
| Exact Mass | 610.21 |
| IUPAC Name | diethyl (4R,5R)-2-[4-[2-[4-[(4R,5R)-4,5-bis(ethoxycarbonyl)-1,3-dioxolan-2-yl]phenyl]ethynyl]phenyl]-1,3-dioxolane-4,5-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1OC(c2ccc(C#Cc3ccc(C4O[C@@H](C(=O)OCC)[C@H](C(=O)OCC)O4)cc3)cc2)O[C@H]1C(=O)OCC |
| InChI | InChI=1S/C32H34O12/c1-5-37-27(33)23-24(28(34)38-6-2)42-31(41-23)21-15-11-19(12-16-21)9-10-20-13-17-22(18-14-20)32-43-25(29(35)39-7-3)26(44-32)30(36)40-8-4/h11-18,23-26,31-32H,5-8H2,1-4H3/t23-,24-,25-,26-/m1/s1 |
| InChIKey | JESTXTUOLKNXQG-VEYUFSJPSA-N |
| XLogP | 2.90 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.61 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|