About ethyl 1-ethoxy-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylate
ethyl 1-ethoxy-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylate (PubChem CID 67768611) has the molecular formula C11H16O5
and a molecular weight of 228.24 g/mol. Its IUPAC name is ethyl 1-ethoxy-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-ethoxy-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylate |
| PubChem CID | 67768611 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | ethyl 1-ethoxy-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylate |
| SMILES | CCOC(=O)C1(OCC)C=C(O)C=CC1O |
| InChI | InChI=1S/C11H16O5/c1-3-15-10(14)11(16-4-2)7-8(12)5-6-9(11)13/h5-7,9,12-13H,3-4H2,1-2H3 |
| InChIKey | YODZYYUMWBJUOM-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1-ethoxy-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-ethoxy-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of ethyl 1-ethoxy-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylate (CID 67768611) is ethyl 1-ethoxy-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for ethyl 1-ethoxy-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for ethyl 1-ethoxy-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylate is CCOC(=O)C1(OCC)C=C(O)C=CC1O.
What is the InChIKey of ethyl 1-ethoxy-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylate?
The InChIKey is YODZYYUMWBJUOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O5/c1-3-15-10(14)11(16-4-2)7-8(12)5-6-9(11)13/h5-7,9,12-13H,3-4H2,1-2H3.
What are the key properties of ethyl 1-ethoxy-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylate?
ethyl 1-ethoxy-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylate has a molecular weight of 228.24 g/mol, XLogP of 0.70, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-ethoxy-3,6-dihydroxycyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 67768611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).