C26H48O4Si — CID 67768696
(1R)-1-[(2S,5R)-5-[(2R,5R)-5-(hydroxymethyl)oxolan-2-yl]-2-(3-trimethylsilylprop-2-ynyl)oxolan-2-yl]undecan-1-ol (PubChem CID 67768696) has the molecular formula C26H48O4Si and a molecular weight of 452.75 g/mol. Its IUPAC name is (1R)-1-[(2S,5R)-5-[(2R,5R)-5-(hydroxymethyl)oxolan-2-yl]-2-(3-trimethylsilylprop-2-ynyl)oxolan-2-yl]undecan-1-ol.
| Compound Name | (1R)-1-[(2S,5R)-5-[(2R,5R)-5-(hydroxymethyl)oxolan-2-yl]-2-(3-trimethylsilylprop-2-ynyl)oxolan-2-yl]undecan-1-ol |
|---|---|
| PubChem CID | 67768696 |
| Molecular Formula | C26H48O4Si |
| Molecular Weight | 452.75 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | (1R)-1-[(2S,5R)-5-[(2R,5R)-5-(hydroxymethyl)oxolan-2-yl]-2-(3-trimethylsilylprop-2-ynyl)oxolan-2-yl]undecan-1-ol |
| SMILES | CCCCCCCCCC[C@@H](O)[C@@]1(CC#C[Si](C)(C)C)CC[C@H]([C@H]2CC[C@H](CO)O2)O1 |
| InChI | InChI=1S/C26H48O4Si/c1-5-6-7-8-9-10-11-12-14-25(28)26(18-13-20-31(2,3)4)19-17-24(30-26)23-16-15-22(21-27)29-23/h22-25,27-28H,5-12,14-19,21H2,1-4H3/t22-,23-,24-,25-,26-/m1/s1 |
| InChIKey | JFTIHABOCDYLCX-ZFXZZAOISA-N |
| XLogP | 5.61 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.75 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|