C41H40N4O5 — CID 67768882
3-[1-(1-amino-3-ethyl-2-hydroxypentan-3-yl)-5-phenylmethoxyindol-3-yl]-4-(5-phenylmethoxy-1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 67768882) has the molecular formula C41H40N4O5 and a molecular weight of 668.79 g/mol. Its IUPAC name is 3-[1-(1-amino-3-ethyl-2-hydroxypentan-3-yl)-5-phenylmethoxyindol-3-yl]-4-(5-phenylmethoxy-1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-(1-amino-3-ethyl-2-hydroxypentan-3-yl)-5-phenylmethoxyindol-3-yl]-4-(5-phenylmethoxy-1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 67768882 |
| Molecular Formula | C41H40N4O5 |
| Molecular Weight | 668.79 g/mol |
| Exact Mass | 668.30 |
| IUPAC Name | 3-[1-(1-amino-3-ethyl-2-hydroxypentan-3-yl)-5-phenylmethoxyindol-3-yl]-4-(5-phenylmethoxy-1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | CCC(CC)(C(O)CN)n1cc(C2=C(c3c[nH]c4ccc(OCc5ccccc5)cc34)C(=O)NC2=O)c2cc(OCc3ccccc3)ccc21 |
| InChI | InChI=1S/C41H40N4O5/c1-3-41(4-2,36(46)21-42)45-23-33(31-20-29(16-18-35(31)45)50-25-27-13-9-6-10-14-27)38-37(39(47)44-40(38)48)32-22-43-34-17-15-28(19-30(32)34)49-24-26-11-7-5-8-12-26/h5-20,22-23,36,43,46H,3-4,21,24-25,42H2,1-2H3,(H,44,47,48) |
| InChIKey | ZIBHLVWUCDKOFT-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 131.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.79 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|