C13H14N4O3S2 — CID 67769142
(3S,6R,10R)-8-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid (PubChem CID 67769142) has the molecular formula C13H14N4O3S2 and a molecular weight of 338.41 g/mol. Its IUPAC name is (3S,6R,10R)-8-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid.
| Compound Name | (3S,6R,10R)-8-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid |
|---|---|
| PubChem CID | 67769142 |
| Molecular Formula | C13H14N4O3S2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | (3S,6R,10R)-8-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid |
| SMILES | Cc1nnc(SCC2=C(C(=O)O)N3C(=O)[C@H]4NC[C@@H](C2)[C@H]43)s1 |
| InChI | InChI=1S/C13H14N4O3S2/c1-5-15-16-13(22-5)21-4-7-2-6-3-14-8-9(6)17(11(8)18)10(7)12(19)20/h6,8-9,14H,2-4H2,1H3,(H,19,20)/t6-,8+,9-/m1/s1 |
| InChIKey | YMUIOAAVKXLVBT-BWVDBABLSA-N |
| XLogP | 0.48 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |