C19H15N4NaO5 — CID 67769536
sodium (1S,10R)-5-[(E)-2-cyanoethenyl]-9-[(4-hydroxyphenyl)carbamoyl]-2-oxo-3,9-diazatricyclo[4.3.1.03,10]dec-4-ene-4-carboxylate (PubChem CID 67769536) has the molecular formula C19H15N4NaO5 and a molecular weight of 402.34 g/mol. Its IUPAC name is sodium (1S,10R)-5-[(E)-2-cyanoethenyl]-9-[(4-hydroxyphenyl)carbamoyl]-2-oxo-3,9-diazatricyclo[4.3.1.03,10]dec-4-ene-4-carboxylate.
| Compound Name | sodium (1S,10R)-5-[(E)-2-cyanoethenyl]-9-[(4-hydroxyphenyl)carbamoyl]-2-oxo-3,9-diazatricyclo[4.3.1.03,10]dec-4-ene-4-carboxylate |
|---|---|
| PubChem CID | 67769536 |
| Molecular Formula | C19H15N4NaO5 |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | sodium (1S,10R)-5-[(E)-2-cyanoethenyl]-9-[(4-hydroxyphenyl)carbamoyl]-2-oxo-3,9-diazatricyclo[4.3.1.03,10]dec-4-ene-4-carboxylate |
| SMILES | N#C/C=C/C1=C(C(=O)[O-])N2C(=O)[C@@H]3[C@H]2C1CCN3C(=O)Nc1ccc(O)cc1.[Na+] |
| InChI | InChI=1S/C19H16N4O5.Na/c20-8-1-2-12-13-7-9-22(19(28)21-10-3-5-11(24)6-4-10)16-14(13)23(17(16)25)15(12)18(26)27;/h1-6,13-14,16,24H,7,9H2,(H,21,28)(H,26,27);/q;+1/p-1/b2-1+;/t13?,14-,16+;/m1./s1 |
| InChIKey | YCNAOCWZZKASOZ-SZIICYKHSA-M |
| XLogP | -3.07 |
| TPSA | 136.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|