C9H10N4 — CID 67769658
(8Z)-1,4,7,10-tetrazatricyclo[5.5.1.04,13]trideca-2,5,8,10-tetraene (PubChem CID 67769658) has the molecular formula C9H10N4 and a molecular weight of 174.21 g/mol. Its IUPAC name is (8Z)-1,4,7,10-tetrazatricyclo[5.5.1.04,13]trideca-2,5,8,10-tetraene.
| Compound Name | (8Z)-1,4,7,10-tetrazatricyclo[5.5.1.04,13]trideca-2,5,8,10-tetraene |
|---|---|
| PubChem CID | 67769658 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | (8Z)-1,4,7,10-tetrazatricyclo[5.5.1.04,13]trideca-2,5,8,10-tetraene |
| SMILES | C1=CN2/C=C\N=C/CN3C=CN1C23 |
| InChI | InChI=1S/C9H10N4/c1-3-11-5-7-13-8-6-12(9(11)13)4-2-10-1/h1-3,5-9H,4H2/b3-1-,10-2- |
| InChIKey | ZUYJEGCGDCFDTI-FDXGLZEBSA-N |
| XLogP | 0.70 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |