C17H14N4O8 — CID 67769944
(6-nitro-2,3-dioxo-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxalin-8-yl) 2-(5-methyl-3-oxo-1,2-oxazol-4-yl)acetate (PubChem CID 67769944) has the molecular formula C17H14N4O8 and a molecular weight of 402.32 g/mol. Its IUPAC name is (6-nitro-2,3-dioxo-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxalin-8-yl) 2-(5-methyl-3-oxo-1,2-oxazol-4-yl)acetate.
| Compound Name | (6-nitro-2,3-dioxo-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxalin-8-yl) 2-(5-methyl-3-oxo-1,2-oxazol-4-yl)acetate |
|---|---|
| PubChem CID | 67769944 |
| Molecular Formula | C17H14N4O8 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | (6-nitro-2,3-dioxo-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxalin-8-yl) 2-(5-methyl-3-oxo-1,2-oxazol-4-yl)acetate |
| SMILES | Cc1o[nH]c(=O)c1CC(=O)OC1Cc2c([N+](=O)[O-])cc3[nH]c(=O)c(=O)[nH]c3c2C1 |
| InChI | InChI=1S/C17H14N4O8/c1-6-8(15(23)20-29-6)4-13(22)28-7-2-9-10(3-7)14-11(5-12(9)21(26)27)18-16(24)17(25)19-14/h5,7H,2-4H2,1H3,(H,18,24)(H,19,25)(H,20,23) |
| InChIKey | NNZATOFBPHITML-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 181.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|