C21H34O5 — CID 67770045
2-[2-[(3aS,4S,5S,6aR)-5-hydroxy-4-(1-hydroxy-5-methyloct-1-enyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethoxy]acetic acid (PubChem CID 67770045) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is 2-[2-[(3aS,4S,5S,6aR)-5-hydroxy-4-(1-hydroxy-5-methyloct-1-enyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethoxy]acetic acid.
| Compound Name | 2-[2-[(3aS,4S,5S,6aR)-5-hydroxy-4-(1-hydroxy-5-methyloct-1-enyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 67770045 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 2-[2-[(3aS,4S,5S,6aR)-5-hydroxy-4-(1-hydroxy-5-methyloct-1-enyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethoxy]acetic acid |
| SMILES | CCCC(C)CCC=C(O)[C@H]1[C@@H]2C=C(CCOCC(=O)O)C[C@@H]2C[C@@H]1O |
| InChI | InChI=1S/C21H34O5/c1-3-5-14(2)6-4-7-18(22)21-17-11-15(8-9-26-13-20(24)25)10-16(17)12-19(21)23/h7,11,14,16-17,19,21-23H,3-6,8-10,12-13H2,1-2H3,(H,24,25)/t14?,16-,17-,19+,21-/m1/s1 |
| InChIKey | WURLQOQBYMLONH-OILLZPDWSA-N |
| XLogP | 4.08 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|