C29H35NO4 — CID 67770391
1-[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-1,2,4,4a,7,7a,10,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]-2-ethyl-2-phenylbutan-1-one (PubChem CID 67770391) has the molecular formula C29H35NO4 and a molecular weight of 461.60 g/mol. Its IUPAC name is 1-[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-1,2,4,4a,7,7a,10,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]-2-ethyl-2-phenylbutan-1-one.
| Compound Name | 1-[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-1,2,4,4a,7,7a,10,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]-2-ethyl-2-phenylbutan-1-one |
|---|---|
| PubChem CID | 67770391 |
| Molecular Formula | C29H35NO4 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | 1-[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-1,2,4,4a,7,7a,10,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]-2-ethyl-2-phenylbutan-1-one |
| SMILES | CCC(CC)(C(=O)C1(O)CC=C2C[C@@H]3[C@@H]4C=C[C@H](O)[C@@H]5OC1=C2[C@]45CCN3C)c1ccccc1 |
| InChI | InChI=1S/C29H35NO4/c1-4-27(5-2,19-9-7-6-8-10-19)26(32)29(33)14-13-18-17-21-20-11-12-22(31)24-28(20,15-16-30(21)3)23(18)25(29)34-24/h6-13,20-22,24,31,33H,4-5,14-17H2,1-3H3/t20-,21+,22-,24-,28-,29?/m0/s1 |
| InChIKey | VIFDUVZQDHNZAL-GHROLBGZSA-N |
| XLogP | 3.67 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|