C12H18O8 — CID 67770969
1-[(3R,4R,5S,6R)-4,5-diacetyl-3,4,5-trihydroxy-6-methoxyoxan-3-yl]ethanone (PubChem CID 67770969) has the molecular formula C12H18O8 and a molecular weight of 290.27 g/mol. Its IUPAC name is 1-[(3R,4R,5S,6R)-4,5-diacetyl-3,4,5-trihydroxy-6-methoxyoxan-3-yl]ethanone.
| Compound Name | 1-[(3R,4R,5S,6R)-4,5-diacetyl-3,4,5-trihydroxy-6-methoxyoxan-3-yl]ethanone |
|---|---|
| PubChem CID | 67770969 |
| Molecular Formula | C12H18O8 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 1-[(3R,4R,5S,6R)-4,5-diacetyl-3,4,5-trihydroxy-6-methoxyoxan-3-yl]ethanone |
| SMILES | CO[C@@H]1OC[C@](O)(C(C)=O)[C@](O)(C(C)=O)[C@@]1(O)C(C)=O |
| InChI | InChI=1S/C12H18O8/c1-6(13)10(16)5-20-9(19-4)11(17,7(2)14)12(10,18)8(3)15/h9,16-18H,5H2,1-4H3/t9-,10+,11-,12-/m1/s1 |
| InChIKey | SGBNTNWAWZCMGU-WRWGMCAJSA-N |
| XLogP | -2.05 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |