C7H11N — CID 67771076
1,2,3,3a,4,5-hexahydrocyclopenta[b]pyrrole (PubChem CID 67771076) has the molecular formula C7H11N and a molecular weight of 109.17 g/mol. Its IUPAC name is 1,2,3,3a,4,5-hexahydrocyclopenta[b]pyrrole.
| Compound Name | 1,2,3,3a,4,5-hexahydrocyclopenta[b]pyrrole |
|---|---|
| PubChem CID | 67771076 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | 1,2,3,3a,4,5-hexahydrocyclopenta[b]pyrrole |
| SMILES | C1=C2NCCC2CC1 |
| InChI | InChI=1S/C7H11N/c1-2-6-4-5-8-7(6)3-1/h3,6,8H,1-2,4-5H2 |
| InChIKey | MZXOCJCQKJUFLE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |