C20H22FN3O5S2 — CID 67771510
1-(4-fluorophenyl)-4-[[4-(1-methyl-3,6-dihydro-2H-pyridin-6-yl)-1,2,5-thiadiazol-3-yl]sulfanyl]butan-1-one;oxalic acid (PubChem CID 67771510) has the molecular formula C20H22FN3O5S2 and a molecular weight of 467.54 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[[4-(1-methyl-3,6-dihydro-2H-pyridin-6-yl)-1,2,5-thiadiazol-3-yl]sulfanyl]butan-1-one;oxalic acid.
| Compound Name | 1-(4-fluorophenyl)-4-[[4-(1-methyl-3,6-dihydro-2H-pyridin-6-yl)-1,2,5-thiadiazol-3-yl]sulfanyl]butan-1-one;oxalic acid |
|---|---|
| PubChem CID | 67771510 |
| Molecular Formula | C20H22FN3O5S2 |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[[4-(1-methyl-3,6-dihydro-2H-pyridin-6-yl)-1,2,5-thiadiazol-3-yl]sulfanyl]butan-1-one;oxalic acid |
| SMILES | CN1CCC=CC1c1nsnc1SCCCC(=O)c1ccc(F)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H20FN3OS2.C2H2O4/c1-22-11-3-2-5-15(22)17-18(21-25-20-17)24-12-4-6-16(23)13-7-9-14(19)10-8-13;3-1(4)2(5)6/h2,5,7-10,15H,3-4,6,11-12H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | GRFAZUYQUWVVNH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 120.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|