C16H21N3O4S — CID 67771612
3-hex-5-enyl-4-(1-methyl-2H-pyridin-5-yl)-1,2,5-thiadiazole;oxalic acid (PubChem CID 67771612) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is 3-hex-5-enyl-4-(1-methyl-2H-pyridin-5-yl)-1,2,5-thiadiazole;oxalic acid.
| Compound Name | 3-hex-5-enyl-4-(1-methyl-2H-pyridin-5-yl)-1,2,5-thiadiazole;oxalic acid |
|---|---|
| PubChem CID | 67771612 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 3-hex-5-enyl-4-(1-methyl-2H-pyridin-5-yl)-1,2,5-thiadiazole;oxalic acid |
| SMILES | C=CCCCCc1nsnc1C1=CN(C)CC=C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H19N3S.C2H2O4/c1-3-4-5-6-9-13-14(16-18-15-13)12-8-7-10-17(2)11-12;3-1(4)2(5)6/h3,7-8,11H,1,4-6,9-10H2,2H3;(H,3,4)(H,5,6) |
| InChIKey | RYIRTALHBMHMEA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 103.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|