About (2R)-1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine;hydrochloride
(2R)-1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine;hydrochloride (PubChem CID 67771715) has the molecular formula C6H13ClN4S
and a molecular weight of 208.72 g/mol. Its IUPAC name is (2R)-1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine;hydrochloride.
Molecular Properties
| Compound Name | (2R)-1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine;hydrochloride |
| PubChem CID | 67771715 |
| Molecular Formula | C6H13ClN4S |
| Molecular Weight | 208.72 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | (2R)-1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine;hydrochloride |
| SMILES | C[C@@H](N)CSc1nncn1C.Cl |
| InChI | InChI=1S/C6H12N4S.ClH/c1-5(7)3-11-6-9-8-4-10(6)2;/h4-5H,3,7H2,1-2H3;1H/t5-;/m1./s1 |
| InChIKey | JSKYSYQYEZOXDY-NUBCRITNSA-N |
| XLogP | 0.68 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.72 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine;hydrochloride?
The IUPAC name of (2R)-1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine;hydrochloride (CID 67771715) is (2R)-1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine;hydrochloride.
What is the SMILES notation for (2R)-1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine;hydrochloride?
The canonical SMILES for (2R)-1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine;hydrochloride is C[C@@H](N)CSc1nncn1C.Cl.
What is the InChIKey of (2R)-1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine;hydrochloride?
The InChIKey is JSKYSYQYEZOXDY-NUBCRITNSA-N. The full InChI is InChI=1S/C6H12N4S.ClH/c1-5(7)3-11-6-9-8-4-10(6)2;/h4-5H,3,7H2,1-2H3;1H/t5-;/m1./s1.
What are the key properties of (2R)-1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine;hydrochloride?
(2R)-1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine;hydrochloride has a molecular weight of 208.72 g/mol, XLogP of 0.68, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine;hydrochloride is sourced from PubChem (CID 67771715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).